IMD 0354
IKKβ inhibitor Immunology/Inflammation|IκB/IKK
| Catalog Number | B1587-S |
| Research Area | Immunology/Inflammation|IκB/IKK |
| Molecular Formula | C15H8ClF6NO2 |
| CAS# | 978-62-1 |
| Purity | 99.68% |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)O |
| Size | Evaluation Sample |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1587 |
