OG-L002
LSD1 inhibitor,potent and specific Chromatin/Epigenetics|Histone Demethylases
| Catalog Number | B1580-5.1 |
| Research Area | Chromatin/Epigenetics|Histone Demethylases |
| Molecular Formula | C15H15NO |
| CAS# | 1357302-64-7 |
| Purity | 98.45% |
| SMILES | C1C(C1N)C2=CC=C(C=C2)C3=CC(=CC=C3)O |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1580 |
