Fexofenadine HCl
Histamine H1 receptor inhibitor Neuroscience|Histamine Receptor
| Catalog Number | B1573-S |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C32H39NO4.HCl |
| CAS# | 153439-40-8 |
| Purity | 99.14% |
| SMILES | CC(C)(C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C(=O)O.Cl |
| Size | Evaluation Sample |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1573 |
