Clemastine Fumarate
Selective histamine H1 receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1558-5.1 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C21H26ClNO.C4H4O4 |
| CAS# | 14976-57-9 |
| Purity | 98.96% |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCCC3CCCN3C.C(=CC(=O)O)C(=O)O |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1558 |
