Dienogest
Orally active synthetic progesterone Endocrinology and Hormones|Estrogen/progestogen Receptor
| Catalog Number | B1516-100 |
| Research Area | Endocrinology and Hormones|Estrogen/progestogen Receptor |
| Molecular Formula | C20H25NO2 |
| CAS# | 65928-58-7 |
| Purity | 99.75% |
| SMILES | CC12CCC3=C4CCC(=O)C=C4CCC3C1CCC2(CC#N)O |
| Size | 100mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1516 |
