Raloxifene HCl
Estrogen receptor (ER) Endocrinology and Hormones|Estrogen/progestogen Receptor
| Catalog Number | B1515-5.1 |
| Research Area | Endocrinology and Hormones|Estrogen/progestogen Receptor |
| Molecular Formula | C28H28ClNO4S |
| CAS# | 82640-04-8 |
| Purity | 99.45% |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)O)C5=CC=C(C=C5)O.Cl |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1515 |
