Estradiol Cypionate
Estrogen receptor agonist Endocrinology and Hormones|Estrogen/progestogen Receptor
| Catalog Number | B1501-5.1 |
| Research Area | Endocrinology and Hormones|Estrogen/progestogen Receptor |
| Molecular Formula | C26H36O3 |
| CAS# | 313-06-4 |
| Purity | 99.91% |
| SMILES | CC12CCC3C(C1CCC2OC(=O)CCC4CCCC4)CCC5=C3C=CC(=C5)O |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1501 |
