Epacadostat
Epacadostat is an oral-available inhibitor of indoleamine 2, 3-dioxygenase (IDO1), increasing the proliferation and activation of various immune cells and reducing tumor-associated regulatory T cells.
| Catalog Number | T3548 |
| Alternative Name(s) | INCB 024360 , IDO Inhibitor 1 |
| Research Area | Metabolism |
| Molecular Formula | C11H13BrFN7O4S |
| CAS# | 1204669-58-8 |
| Purity | 98.56% |
| SMILES | NS(=O)(=O)NCCNc1nonc1\C(Nc1ccc(F)c(Br)c1)=N\O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Epacadostat |
| Additional Information | https://www.targetmol.com/datasheet/T3548 |
