PP1
PP1, a specific and effective Src inhibitor, is with IC50 for Lck/Fyn is 5 nM/ 6 nM, respectively.
| Catalog Number | T6196 |
| Alternative Name(s) | EI 275 , AGL 1872 |
| Research Area | JAK/STAT signaling|||Angiogenesis|||Apoptosis|||Cytoskeletal Signaling|||Tyrosine Kinase/Adaptors |
| Molecular Formula | C16H19N5 |
| CAS# | 172889-26-8 |
| Purity | 99.82% |
| SMILES | Cc1ccc(cc1)c1nn(c2ncnc(N)c12)C(C)(C)C |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/PP1 |
| Additional Information | https://www.targetmol.com/datasheet/T6196 |