APD668
APD668 is a potent GPR119 agonist with EC50 of 2.7 nM and 33 nM for hGPR119 and ratGPR119, respectively.
| Catalog Number | T2088 |
| Alternative Name(s) | APD 668 |
| Research Area | GPCR/G Protein|||Membrane transporter/Ion channel|||Endocrinology/Hormones|||Metabolism |
| Molecular Formula | C21H24FN5O5S |
| CAS# | 832714-46-2 |
| Purity | 99.97% |
| SMILES | O=C(N1CCC(Oc2ncnc3c2cnn3c2ccc(S(=O)(=O)C)cc2F)CC1)OC(C)C |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/APD668 |
| Additional Information | https://www.targetmol.com/datasheet/T2088 |
