Gracillin
Gracillin can induce cell cycle arrest, oxidative stress, and apoptosis in HL60 cells, and has the potential to be developed as an antitumor agent. Gracillin can be selected as lead compounds for the development of new drugs against I. multifiliis.
| Catalog Number | T3774 |
| Alternative Name(s) | 山药 |
| Research Area | Cell Cycle/Checkpoint |
| Molecular Formula | C45H72O17 |
| CAS# | 19083-00-2 |
| SMILES | [C@@H]1([C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)O[C@@H]1CC2=CC[C@H]3[C@@H]4C[C@@H]5O[C@@]6([C@H]([C@@H]5[C@]4(CC[C@@H]3[C@]2(CC1)C)C)C)CC[C@H](CO6)C)CO)O |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/Gracillin |
| Additional Information | https://www.targetmol.com/datasheet/T3774 |