SNS-314 Mesylate
SNS-314 Mesylate (SNS-314) is an effective and specific Aurora A/B/C inhibitor (IC50: 9/31/3 nM). It is less inhibition of Trk A/B, Fms, Flt4, c-Raf, Axl, and DDR2.
| Catalog Number | T2617 |
| Alternative Name(s) | SNS-314 |
| Research Area | Cell Cycle/Checkpoint|||Chromatin/Epigenetic |
| Molecular Formula | C18H15ClN6OS2·CH4O3S |
| CAS# | 1146618-41-8 |
| SMILES | CS(=O)(=O)O.Clc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4c3scc4)s2)c1 |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/SNS-314 Mesylate |
| Additional Information | https://www.targetmol.com/datasheet/T2617 |
