Alogliptin Benzoate
Alogliptin Benzoate(SYR 322), an effective and specific DPP-4 inhibitor (IC50<10 nM), exhibits greater than 10, 000-fold selectivity over DPP-8/9. Alogliptin may inhibit inflammatory responses by preventing the toll-like receptor 4 (TLR-4)-mediated formation of proinflammatory cytokines.
| Catalog Number | T2401 |
| Alternative Name(s) | SYR 322 , Alogliptin(SYR-322)benzoate |
| Research Area | Apoptosis|||Proteases/Proteasome|||Ubiquitination |
| Molecular Formula | C25H27N5O4 |
| CAS# | 850649-62-6 |
| SMILES | Cn1c(=O)cc(n(c1=O)Cc1ccccc1C#N)N1CCC[C@H](C1)N.c1ccc(cc1)C(=O)O |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Alogliptin Benzoate |
| Additional Information | https://www.targetmol.com/datasheet/T2401 |
