Phthalic acid mono-2-ethylhexyl ester
Phthalic acid mono-2-ethylhexyl ester (Phthalic Acid Monooctyl Ester is a major bioactive metabolite of diethylhexyl phthalate (DEHP), which inhibits the 17, 20 lyase activity of CYP17. Cyp17a1 gene is a specific target to MEHP explaining the MEHP-induced suppression of steroidogenesis observed.
| Catalog Number | T0603 |
| Alternative Name(s) | Phthalic Acid Monooctyl Ester |
| Research Area | Metabolism |
| Molecular Formula | C16H22O4 |
| CAS# | 4376-20-9 |
| Purity | 99.91% |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)O |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Phthalic acid mono-2-ethylhexyl ester |
| Additional Information | https://www.targetmol.com/datasheet/T0603 |
