Progesterone
Progesterone is the major progestational steroid that is secreted primarily by the CORPUS LUTEUM and the PLACENTA. Progesterone acts on the UTERUS, the MAMMARY GLANDS and the BRAIN. It is required in EMBRYO IMPLANTATION; PREGNANCY maintenance, and the development of mammary tissue for MILK production.
| Catalog Number | T0478 |
| Alternative Name(s) | 孕酮 , Pregn-4-ene-3,20-dione |
| Research Area | Others|||GPCR/G Protein|||Metabolism|||Endocrinology/Hormones|||Neuroscience |
| Molecular Formula | C21H30O2 |
| CAS# | 57-83-0 |
| Purity | 99.86% |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Progesterone |
| Additional Information | https://www.targetmol.com/datasheet/T0478 |
