Umifenovir hydrochloride
Arbidol (Umifenovir) hydrochloride, an broad-spectrum antiviral chemical agent, can inhibit cell invade of enveloped viruses by blocking viral fusion with host cell membrane.
| Catalog Number | T0104 |
| Alternative Name(s) | Arbidol hydrochloride , Arbidol HCl |
| Research Area | Microbiology/Virology |
| Molecular Formula | C22H25BrN2O3S·HCl |
| CAS# | 131707-23-8 |
| Purity | 99.85% |
| SMILES | Cl.CCOC(=O)c1c(CSc2ccccc2)n(C)c2cc(Br)c(O)c(CN(C)C)c12 |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/Umifenovir hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T0104 |
