Bupivacaine hydrochloride
Bupivacaine Hydrochloride is a long-acting, amide-type local anesthetic. Bupivacaine reversibly binds to specific sodium ion channels in the neuronal membrane, resulting in a decrease in the voltage-dependent membrane permeability to sodium ions and membrane stabilization; inhibition of depolarization and nerve impulse conduction; and a reversible loss of sensation.
| Catalog Number | T0030 |
| Alternative Name(s) | Vivacaine , Bupivacaine HCl |
| Research Area | Membrane transporter/Ion channel |
| Molecular Formula | C18H28N2O·HCl |
| CAS# | 18010-40-7 |
| SMILES | Cl.CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Bupivacaine hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T0030 |
