Valnemulin hydrochloride
Valnemulin hydrochloride (Valnemulin HCl) is a broad-spectrum bacteriostatic agent inhibiting protein synthesis in bacteria by binding to the peptidyl transferase component of the 50S subunit of ribosomes.
| Catalog Number | T6715 |
| Alternative Name(s) | Valnemulin HCl |
| Research Area | Microbiology/Virology|||Others |
| Molecular Formula | C31H52N2O5S·HCl |
| CAS# | 133868-46-9 |
| Purity | 99.83% |
| SMILES | Cl.CC(C)[C@@H](N)C(=O)NCC(C)(C)SCC(=O)O[C@@H]1C[C@@](C)(C=C)[C@@H](O)[C@H](C)[C@]23CCC(=O)[C@H]2[C@@]1(C)[C@H](C)CC3 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Valnemulin hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T6715 |
