5-Acetylsalicylic acid
5-Acetylsalicylic acid has anti-inflammatory effects and can be used to treat inflammatory bowel disease, including ulcerative colitis, inflamed anus or rectum, and to maintain remission in Crohn’s disease.
| Catalog Number | T2735 |
| Alternative Name(s) | 5-acetyl-2-hydroxybenzoic acid |
| Research Area | Others |
| Molecular Formula | C9H8O4 |
| CAS# | 13110-96-8 |
| SMILES | CC(=O)c1ccc(O)c(c1)C(O)=O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/5-Acetylsalicylic acid |
| Additional Information | https://www.targetmol.com/datasheet/T2735 |