17α-Hydroxyprogesterone
17α-Hydroxyprogesterone (17-OHP) is a physiological progestin that is produced during glucocorticoid and steroid hormone synthesis and is increased during the third trimester of pregnancy. Hydroxyprogesterone binds to the cytoplasmic progesterone receptors in the reproductive system and subsequently activates progesterone receptor-mediated gene expression.
| Catalog Number | T1429 |
| Alternative Name(s) | Hydroxyprogesterone , 17-OHP , 17-Hydroxyprogesterone |
| Research Area | Endocrinology/Hormones|||Others|||Metabolism |
| Molecular Formula | C21H30O3 |
| CAS# | 68-96-2 |
| Purity | 99.79% |
| SMILES | [C@H]12[C@H]3[C@@]([C@](CC3)(C(=O)C)O)(CC[C@@H]1[C@@]1(C(=CC(=O)CC1)CC2)C)C |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/17α-Hydroxyprogesterone |
| Additional Information | https://www.targetmol.com/datasheet/T1429 |
