Dovitinib
Dovitinib (TKI258, CHIR258) is a multitargeted RTK inhibitor, mostly for class III (FLT3/c-Kit, IC50: 1/2 nM), also effective to class IV (FGFR1/3) and class V (VEGFR1-4) RTKs (IC50: 8-13 nM), less potent to EGFR, InsR, EphA2, c-Met, IGF-1R, Tie2, and HER2.
| Catalog Number | T6289 |
| Alternative Name(s) | TKI258 , CHIR-258 |
| Research Area | Tyrosine Kinase/Adaptors|||Angiogenesis |
| Molecular Formula | C21H21FN6O |
| CAS# | 405169-16-6 |
| Purity | 99.66% |
| SMILES | CN1CCN(CC1)c1ccc2nc([nH]c2c1)-c1c(N)c2c(F)cccc2[nH]c1=O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Dovitinib |
| Additional Information | https://www.targetmol.com/datasheet/T6289 |
