10058-F4
10058-F4 is a cell-permeable thiazolidinone that specifically inhibits the c-Myc-Max interaction and prevents transactivation of c-Myc target gene expression; induces cell-cycle arrest and apoptosis.
| Catalog Number | T3048 |
| Alternative Name(s) | c-Myc Inhibitor |
| Research Area | Autophagy|||Cell Cycle/Checkpoint |
| Molecular Formula | C12H11NOS2 |
| CAS# | 403811-55-2 |
| Purity | 99.82% |
| SMILES | CCC1=CC=C(\C=C2\SC(S)=NC2=O)C=C1 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/10058-F4 |
| Additional Information | https://www.targetmol.com/datasheet/T3048 |
