Honokiol
Honokiol is the active principle of magnolia extract. It inhibits the activation of Akt and enhances the phosphorylation of ERK1/ERK2.
| Catalog Number | T3001 |
| Alternative Name(s) | NSC 293100 |
| Research Area | Cytoskeletal Signaling|||Autophagy|||Proteases/Proteasome|||PI3K/Akt/mTOR signaling|||Microbiology/Virology|||MAPK |
| Molecular Formula | C18H18O2 |
| CAS# | 35354-74-6 |
| Purity | 99.87% |
| SMILES | C=CCc1cc(c(cc1)O)c1cc(c(cc1)O)CC=C |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Honokiol |
| Additional Information | https://www.targetmol.com/datasheet/T3001 |
