Paritaprevir
Paritaprevir is an orally bioavailable, synthetic acylsulfonamide inhibitor of the hepatitis C virus (HCV) protease complex comprised of non-structural protein 3 and 4A (NS3/NS4A), with potential activity against HCV genotype 1. Upon administration, paritaprevir reversibly binds to the active center and binding site of the HCV NS3/NS4A protease and prevents NS3/NS4A protease-mediated polyprotein maturation. This disrupts both the processing of viral proteins and the formation of the viral replication complex, which inhibits viral replication in HCV genotype 1-infected host cells. NS3, a serine protease, is essential for the proteolytic cleavage of multiple sites within the HCV polyprotein and plays a key role during HCV ribonucleic acid (RNA) replication. NS4A is an activating factor for NS3. HCV is a small, enveloped, single-stranded RNA virus belonging to the Flaviviridae family, and infection is associated with the development of hepatocellular carcinoma (HCC).
| Catalog Number | T3226 |
| Alternative Name(s) | ABT-450 , Veruprevir |
| Research Area | Microbiology/Virology|||Proteases/Proteasome |
| Molecular Formula | C40H43N7O7S |
| CAS# | 1221573-85-8 |
| Purity | 99.57% |
| SMILES | Cc1cnc(cn1)C(=O)N[C@H]1CCCCC\C=C/[C@@H]2C[C@]2(NC(=O)[C@@H]2C[C@H](CN2C1=O)Oc1nc2ccccc2c2ccccc12)C(=O)NS(=O)(=O)C1CC1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Paritaprevir |
| Additional Information | https://www.targetmol.com/datasheet/T3226 |
