Danofloxacin mesylate
Danofloxacin is a synthetic antibacterial agent of the fluoroquinolone class, acts principally by the inhibition of bacterial DNA-gyrase.
| Catalog Number | T1276 |
| Alternative Name(s) | CP 76136-27 |
| Research Area | Microbiology/Virology|||DNA Damage/DNA Repair|||Cell Cycle/Checkpoint |
| Molecular Formula | C19H20FN3O3·CH4O3S |
| CAS# | 119478-55-6 |
| Purity | 99.66% |
| SMILES | O=S(=O)(C)O.C1CC1n1c2cc(c(cc2c(=O)c(c1)C(=O)O)F)N1[C@@H]2CN([C@H](C1)C2)C |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/Danofloxacin mesylate |
| Additional Information | https://www.targetmol.com/datasheet/T1276 |