AST 487
AST 487 is a RET kinase inhibitor, inhibiting RET autophosphorylation and activation of downstream effectors. It also can inhibit Flt-3.
| Catalog Number | T4053 |
| Alternative Name(s) | NVP-AST 487 |
| Research Area | Angiogenesis|||Cytoskeletal Signaling|||Tyrosine Kinase/Adaptors|||Apoptosis |
| Molecular Formula | C26H30F3N7O2 |
| CAS# | 630124-46-8 |
| Purity | 98.17% |
| SMILES | CNc1cc(Oc2ccc(NC(=O)Nc3ccc(CN4CCN(CC)CC4)c(C(F)(F)F)c3)cc2)ncn1 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/AST 487 |
| Additional Information | https://www.targetmol.com/datasheet/T4053 |
