Nevirapine
Nevirapine is a benzodiazepine non-nucleoside reverse transcriptase inhibitor. In combination with other antiretroviral drugs, nevirapine reduces HIV viral loads and increases CD4 counts, thereby retarding or preventing the damage to the immune system and reducing the risk of developing AIDS.
| Catalog Number | T1595 |
| Alternative Name(s) | NSC 641530 , BI-RG 587 , NVP |
| Research Area | Microbiology/Virology|||Proteases/Proteasome |
| Molecular Formula | C15H14N4O |
| CAS# | 129618-40-2 |
| Purity | 99.60% |
| SMILES | Cc1ccnc2N(C3CC3)c3ncccc3C(=O)Nc12 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Nevirapine |
| Additional Information | https://www.targetmol.com/datasheet/T1595 |
