Ranitidine
Ranitidine is a non-imidazole blocker of those histamine receptors that mediate gastric secretion (H2 receptors). It is used to treat gastrointestinal ulcers.
| Catalog Number | T3610 |
| Alternative Name(s) | HSDB 3925 , Ranitidin |
| Research Area | GPCR/G Protein|||Microbiology/Virology|||Immunology/Inflammation|||Neuroscience|||Metabolism |
| Molecular Formula | C13H22N4O3S |
| CAS# | 66357-35-5 |
| Purity | 99.10% |
| SMILES | CNC(NCCSCc1ccc(CN(C)C)o1)=C[N+]([O-])=O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Ranitidine |
| Additional Information | https://www.targetmol.com/datasheet/T3610 |
