Famciclovir
Famciclovir is a Herpes Simplex Virus Nucleoside Analog DNA Polymerase Inhibitor. The mechanism of action of famciclovir is as a DNA Polymerase Inhibitor, and DNA Polymerase Inhibitor.
| Catalog Number | T1646 |
| Alternative Name(s) | BRL 42810 |
| Research Area | DNA Damage/DNA Repair|||Cell Cycle/Checkpoint|||Microbiology/Virology |
| Molecular Formula | C14H19N5O4 |
| CAS# | 104227-87-4 |
| Purity | 99.58% |
| SMILES | CC(=O)OCC(CCn1cnc2cnc(N)nc12)COC(C)=O |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Famciclovir |
| Additional Information | https://www.targetmol.com/datasheet/T1646 |
