Purmorphamine
Purmorphamine, which directly binds and activates Smoothened, blocks BODIPY-cyclopamine binding to Smo. It also is an inducer of osteoblast differentiation.
| Catalog Number | T1810 |
| Alternative Name(s) | Shh Signaling Antagonist VI |
| Research Area | Autophagy|||Stem Cells|||GPCR/G Protein |
| Molecular Formula | C31H32N6O2 |
| CAS# | 483367-10-8 |
| Purity | 98.11% |
| SMILES | C1CCC(CC1)n1cnc2c(Nc3ccc(cc3)N3CCOCC3)nc(Oc3cccc4ccccc34)nc12 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/Purmorphamine |
| Additional Information | https://www.targetmol.com/datasheet/T1810 |
