Lomefloxacin hydrochloride
Lomefloxacin hydrochloride inhibits DNA gyrase, a type II topoisomerase involved in the induction or relaxation of supercoiling during DNA replication. This inhibition leads to a decrease in DNA synthesis during bacterial replication, resulting in cell growth inhibition and eventually cell lysis. Lomefloxacin Hydrochloride is the hydrochloride salt form of lomefloxacin, a synthetic broad-spectrum fluoroquinolone with antibacterial activity.
| Catalog Number | T1625 |
| Alternative Name(s) | Lomefloxacin HCl , Okacyn , Maxaquin |
| Research Area | DNA Damage/DNA Repair|||Microbiology/Virology |
| Molecular Formula | C17H20ClF2N3O3 |
| CAS# | 98079-52-8 |
| Purity | 99.43% |
| SMILES | C1(NCCN(C1)c1c(cc2c(c1F)n(cc(c2=O)C(=O)O)CC)F)C.Cl |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Lomefloxacin hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T1625 |
