Cucurbitacin B
Cucurbitacin B has profound in vitro and in vivo antiproliferative effects against human pancreatic Y cells. It inhibited AKT signaling activation through up-regulation of PTEN. Cucurbitacin B is an effective inhibitor of HIF-1 and provide new perspectives into the mechanism of its anticancer activity. Cucurbitacin B inhibits proliferation and induces apoptosis via STAT3 pathway inhibition in A549 lung Y cells.
| Catalog Number | T3404 |
| Alternative Name(s) | Cuc B , DATISCACIN , Amarine |
| Research Area | Stem Cells|||Metabolism|||Chromatin/Epigenetic|||Autophagy|||PI3K/Akt/mTOR signaling|||Apoptosis|||Cytoskeletal Signaling|||JAK/STAT signaling|||Angiogenesis |
| Molecular Formula | C32H46O8 |
| CAS# | 6199-67-3 |
| Purity | 99.08% |
| SMILES | C(=O)(C)OC(C)(/C=C/C(=O)[C@](C)(O)[C@H]1[C@@H](C[C@]2([C@@H]3CC=C4C(C(=O)[C@H](C[C@H]4[C@@]3(C(=O)C[C@]12C)C)O)(C)C)C)O)C |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Cucurbitacin B |
| Additional Information | https://www.targetmol.com/datasheet/T3404 |