Necrosulfonamide
(E)-Necrosulfonamide is an inhibitor of necroptosis. Blocks mixed lineage kinase domain-like protein (MLKL), a critical substrate of receptor-interacting serine-threonine kinase 3 (RIP3) during necrosis. Prevents MLKL-RIP1-RIP3 necrosome complex from interacting with downstream necrosis effectors. Binds and inhibits gasdermin D. Inhibits pyroptosis.
| Catalog Number | T6904 |
| Alternative Name(s) | (E)-Necrosulfonamide |
| Research Area | MAPK |
| Molecular Formula | C18H15N5O6S2 |
| CAS# | 1360614-48-7 |
| Purity | 99.17% |
| SMILES | COC1=C(NS(=O)(=O)C2=CC=C(NC(=O)\C=C\C3=CC=C(S3)[N+]([O-])=O)C=C2)N=CC=N1 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/（E）-Necrosulfonamide |
| Additional Information | https://www.targetmol.com/datasheet/T6904 |