Rizatriptan benzoate
Rizatriptan benzoate selectively binds to and activates serotonin (5-HT) 1B receptors and 5-HT 1D receptors providing relief of migraine headaches.
| Catalog Number | T1512 |
| Alternative Name(s) | MK-462 Benzoate |
| Research Area | Neuroscience|||GPCR/G Protein |
| Molecular Formula | C22H25N5O2 |
| CAS# | 145202-66-0 |
| Purity | 99.00% |
| SMILES | c1cccc(c1)C(=O)O.[nH]1cc(c2cc(ccc12)Cn1ncnc1)CCN(C)C |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Rizatriptan benzoate |
| Additional Information | https://www.targetmol.com/datasheet/T1512 |