CA-074 methyl ester
CA-074 methyl ester is a specific inhibitor of Cathepsin B with neuroprotective, anti-cancer, and anti-inflammatory effects.
| Catalog Number | T3420 |
| Alternative Name(s) | Cathepsin B Inhibitor IV , CA-074Me |
| Research Area | Proteases/Proteasome |
| Molecular Formula | C19H31N3O6 |
| CAS# | 147859-80-1 |
| Purity | 97.26% |
| SMILES | CCCNC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1CCC[C@H]1C(=O)OC |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/CA-074 methyl ester |
| Additional Information | https://www.targetmol.com/datasheet/T3420 |