β-Hederin
1. β-Hederin has antileishmanial activity. 2. β-Hederin has apoptotic effect on breast cancer cells, it could be a promising candidate for chemotherapy of breast cancer.
| Catalog Number | T3S0205 |
| Alternative Name(s) | Beta-Hederin |
| Research Area | Microbiology/Virology |
| Molecular Formula | C41H66O11 |
| CAS# | 35790-95-5 |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O)CO[C@H]2O[C@H]2CC[C@@]3(C)[C@@H](CC[C@]4(C)[C@@H]3CC=C3[C@@H]5CC(C)(C)CC[C@@]5(CC[C@@]43C)C(O)=O)C2(C)C)[C@H](O)[C@H](O)[C@H]1O |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/β-Hederin |
| Additional Information | https://www.targetmol.com/datasheet/T3S0205 |