G418 Disulfate
G418 Disulfate is an aminoglycoside antibiotic similar in structure to gentamicin B1 and blocks polypeptide synthesis by inhibiting the elongation step in both prokaryotic and eukaryotic cells.
| Trivial name | Geneticin(G418 Sulfate); Geneticin Sulfate; Gentamicin Sulfate; Antibiotic G 418 Sulfate |
| Catalog Number | CSN11069 |
| Alternative Name(s) | Geneticin(G418 Sulfate); Geneticin Sulfate; Gentamicin Sulfate; Antibiotic G 418 Sulfate |
| Research Area | / |
| Molecular Formula | C20H44N4O18S2 |
| CAS# | 108321-42-2 |
| SMILES | O=S(O)(O)=O.O[C@@H]([C@@H]1O[C@@]([C@@H]([C@@H](O)[C@@H]2O)N)([H])O[C@]2([H])[C@H](O)C)[C@H]([C@@H](C[C@@H]1N)N)O[C@](OC[C@](C)(O)[C@@H]3NC)([H])[C@@H]3O.O=S(O)(O)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/g418-disulfate.html |
