Bleomycin Sulfate
Bleomycin sulfate is a glycopeptide antitumor antibiotic produced by the bacterium S. verticillus. It functions by breaking single- and double-strand DNA in tumor cells and interrupts the cell cycle.
| Trivial name | NSC 125066; Bleo; Blexane |
| Catalog Number | CSN10472 |
| Alternative Name(s) | NSC 125066; Bleo; Blexane |
| Research Area | Cancer |
| Molecular Formula | C55H85N17O25S4 |
| CAS# | 41432-97-7 |
| SMILES | C[S+](CCCNC(C1=CSC(C2=CSC(CCNC(C(C(O)C)NC(C(C)C(O)C(C)NC(C(C(O[C@H]3[C@@H](O[C@@H]4[C@@H](O)[C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O4)[C@@H](O)[C@H](O)[C@H](CO)O3)C5=CN=CN5)NC(C6=NC(C(NCC(N)C(N)=O)CC(N)=O)=NC(N)=C6C)=O)=O)=O)=O)=N2)=N1)=O)C.[O-]S(=O)(O)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/bleomycin-sulfate.html |
