Lincomycin HCl H2O
Lincomycin HCl is a narrow-spectrum antibiotic, has similar effects to erythromycin, which has a good effect on Gram-positive coccus, mainly used to inhibit the synthesis of bacterial cell protein.
| Trivial name | / |
| Catalog Number | CSN11304 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C18H37ClN2O7S |
| CAS# | 7179-49-9 |
| SMILES | C[C@@H](O)[C@](NC([C@H]1N(C)C[C@H](CCC)C1)=O)([H])[C@@]2([H])O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O.Cl.O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/lincomycin-hcl-h2o.html |
