Erythromycin Ethylsuccinate
Erythromycin ethylsuccinate is an antibiotic useful for the treatment of a number of bacterial infections, has an antimicrobial spectrum similar to or slightly wider than that of penicillin.
| Trivial name | EES |
| Catalog Number | CSN10933 |
| Alternative Name(s) | EES |
| Research Area | Infection |
| Molecular Formula | C43H75NO16 |
| CAS# | 1264-62-6 |
| SMILES | O=C(CCC(OCC)=O)O[C@H]([C@H]1N(C)C)[C@](O[C@H](C)C1)([H])O[C@@H]([C@](O)(C[C@H](C([C@@H]([C@@H](O)[C@@]2(O)C)C)=O)C)C)[C@H]([C@@H]([C@H](C(O[C@@H]2CC)=O)C)O[C@@](O[C@@H](C)[C@@H]3O)([H])C[C@@]3(C)OC)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/erythromycin-ethylsuccinate.html |
