L-Isoleucine
L-Isoleucine is a nonpolar hydrophobic amino acid, can be used in capillary feeder (CAFE) assay to determine the consumption of amino acids by Drosophila melanogaster, as well as a supplement for synthetic complete (SC) media.
| Trivial name | H-Ile-OH;(2S,3S)-2-Amino-3-methylpentanoic acid |
| Catalog Number | CSN23582 |
| Alternative Name(s) | H-Ile-OH;(2S,3S)-2-Amino-3-methylpentanoic acid |
| Research Area | / |
| Molecular Formula | C6H13NO2 |
| CAS# | 73-32-5 |
| Purity | ≥99% |
| SMILES | N[C@@H]([C@@H](C)CC)C(O)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/l-isoleucine.html |
