C-176
C-176 is a STING inhibitor with anti-inflammatory effect. It blocks the palmitoylation of STING by covalently targeting the transmembrane cysteine residue 91.
| Trivial name | STING inhibitor C-176 |
| Catalog Number | CSN22907 |
| Alternative Name(s) | STING inhibitor C-176 |
| Research Area | / |
| Molecular Formula | C11H7IN2O4 |
| CAS# | 314054-00-7 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC=C([N+]([O-])=O)O1)NC2=CC=C(I)C=C2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/c-176.html |