SC-560
SC-560 is a highly selective cyclooxygenase-1 (COX-1) inhibitor (IC50 values are 0.009 and 6.3 μM for COX-1 and COX-2 respectively). It inhibits COX-1-derived platelet thromboxane B2, gastric PGE2 and dermal PDE2 production and significantly reduces ovarian surface epithelial tumor growth in vivo.
| Trivial name | / |
| Catalog Number | CSN20354 |
| Alternative Name(s) | / |
| Research Area | Cancer|Immunology/Inflammation |
| Molecular Formula | C17H12ClF3N2O |
| CAS# | 188817-13-2 |
| Purity | ≥99% |
| SMILES | FC(C1=NN(C2=CC=C(OC)C=C2)C(C3=CC=C(Cl)C=C3)=C1)(F)F |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/sc-560.html |
