Diosbulbin B
Diosbulbin B, a natural product isolated and purified from the roots of Dioscorea bulbifera, has potential anti-tumor effects which may be related to influencing the immune system for the first time.
| Trivial name | Diosbulbin-B |
| Catalog Number | CSN19917 |
| Alternative Name(s) | Diosbulbin-B |
| Research Area | / |
| Molecular Formula | C19H20O6 |
| CAS# | 20086-06-0 |
| Purity | ≥99% |
| SMILES | O=C1O[C@]2([H])[C@@]3([H])[C@](C[C@@]4([H])OC([C@]3([H])C4)=O)([H])[C@@]5(C)[C@]1(C2)O[C@@H](C6=COC=C6)C5 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/diosbulbin-b.html |
