Cepharanthine
Cepharanthine is a naturally occurring alkaloid extracted from the plant Stephania cepharantha Hayata. It possesses potency of antiinflammatory, antineoplastic and effect against HTLV.
| Trivial name | NSC 623442 |
| Catalog Number | CSN19471 |
| Alternative Name(s) | NSC 623442 |
| Research Area | Cancer |
| Molecular Formula | C37H38N2O6 |
| CAS# | 481-49-2 |
| Purity | ≥99% |
| SMILES | CN1[C@]([H])(C2=C(C=C3OCOC3=C2OC4=C(C=C5C([C@@]([H])(C6)N(C)CC5)=C4)OC)CC1)CC(C=C7)=CC=C7OC8=CC6=CC=C8OC |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/cepharanthine.html |