Puerarin
Puerarin, an isoflavones, is antagonist of 5-HT2C receptor and benzodiazepine site that can reduce anxiety symptoms associated with alcohol withdrawal. Puerarin is found in the root of radix puerariae.
| Trivial name | Kakonein |
| Catalog Number | CSN19422 |
| Alternative Name(s) | Kakonein |
| Research Area | / |
| Molecular Formula | C21H20O10 |
| CAS# | 3681-99-0 |
| Purity | ≥99% |
| SMILES | OC1=C([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(OC=C3C4=CC=C(O)C=C4)=C(C=C1)C3=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/puerarin.html |
