Tanshinone IIA
Tanshinone IIA is a naturally occuring cardioprotective agent which can inhibit NF-κB and AP-1 DNA binding and display antioxidant and anti-inflammatory properties. Tanshinone IIA showed inhibitory effect on PL(pro) with IC50 value of 1.6μM and less inhibitory effect on 3CLpro with IC50 value of 89.1μM.
| Trivial name | Tanshinone B; Dan Shen Ketone |
| Catalog Number | CSN19410 |
| Alternative Name(s) | Tanshinone B; Dan Shen Ketone |
| Research Area | Cancer|Cardiovascular Disease |
| Molecular Formula | C19H18O3 |
| CAS# | 568-72-9 |
| Purity | ≥99% |
| SMILES | CC1=COC(C2=C(C3=O)C(CCCC(C)4C)=C4C=C2)=C1C3=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tanshinone-iia.html |