Naringenin
Naringenin could suppess ERK2 activity and decrease stability of FRA1. It is a predominant flavanone derived from plant food with antioxidant effect.
| Trivial name | Naringetol; NSC-34875; S-Dihydrogenistein; NSC 11855 |
| Catalog Number | CSN18704 |
| Alternative Name(s) | Naringetol; NSC-34875; S-Dihydrogenistein; NSC 11855 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C15H12O5 |
| CAS# | 480-41-1 |
| Purity | ≥97% |
| SMILES | O=C1C[C@@H](C2=CC=C(O)C=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/naringenin.html |