Scopoletin
Scopoletin has important anti-inflammatory activity by inhibiting the phosphorylation of NF-κB and p38 MAPK.
| Trivial name | Esculetin 6-methyl ether; Gelseminic acid; 6-Methylesculetin; Chrysatropic acid |
| Catalog Number | CSN16503 |
| Alternative Name(s) | Esculetin 6-methyl ether; Gelseminic acid; 6-Methylesculetin; Chrysatropic acid |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C10H8O4 |
| CAS# | 92-61-5 |
| Purity | ≥99% |
| SMILES | COC1=C(O)C=C2OC(=O)C=CC2=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/scopoletin.html |
