Esculin
Esculin is a glucoside isolated and purified from the peel of Aesculus hippocastanum L., possessing antiflogistic, cytostatic, and antimutagenic properties, and is used for the treatment of various peripheral vascular disorders and in a microbiology laboratory to aid in the identification of bacterial species (especially Enterococci and Listeria).
| Trivial name | Aesculin |
| Catalog Number | CSN16387 |
| Alternative Name(s) | Aesculin |
| Research Area | / |
| Molecular Formula | C15H16O9 |
| CAS# | 531-75-9 |
| Purity | ≥99% |
| SMILES | O=C1OC2=CC(O)=C(C=C2C=C1)O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/esculin.html |
